C22H39N3O8P2 — CID 87256095
aminophosphonous acid;butane;5-[[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxymethyl]benzene-1,3-dicarboxylic acid (PubChem CID 87256095) has the molecular formula C22H39N3O8P2 and a molecular weight of 535.52 g/mol. Its IUPAC name is aminophosphonous acid;butane;5-[[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxymethyl]benzene-1,3-dicarboxylic acid.
| Compound Name | aminophosphonous acid;butane;5-[[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxymethyl]benzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 87256095 |
| Molecular Formula | C22H39N3O8P2 |
| Molecular Weight | 535.52 g/mol |
| Exact Mass | 535.22 |
| IUPAC Name | aminophosphonous acid;butane;5-[[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxymethyl]benzene-1,3-dicarboxylic acid |
| SMILES | CC(C)N(C(C)C)P(OCCC#N)OCc1cc(C(=O)O)cc(C(=O)O)c1.CCCC.NP(O)O |
| InChI | InChI=1S/C18H25N2O6P.C4H10.H4NO2P/c1-12(2)20(13(3)4)27(25-7-5-6-19)26-11-14-8-15(17(21)22)10-16(9-14)18(23)24;1-3-4-2;1-4(2)3/h8-10,12-13H,5,7,11H2,1-4H3,(H,21,22)(H,23,24);3-4H2,1-2H3;2-3H,1H2 |
| InChIKey | ZGZKXPYAGXNUJN-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 186.57 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.52 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|