C10H10F8O — CID 87256327
4,5,5,5-tetrafluoro-3-(4,5,5,5-tetrafluoropent-1-en-3-yloxy)pent-1-ene (PubChem CID 87256327) has the molecular formula C10H10F8O and a molecular weight of 298.17 g/mol. Its IUPAC name is 4,5,5,5-tetrafluoro-3-(4,5,5,5-tetrafluoropent-1-en-3-yloxy)pent-1-ene.
| Compound Name | 4,5,5,5-tetrafluoro-3-(4,5,5,5-tetrafluoropent-1-en-3-yloxy)pent-1-ene |
|---|---|
| PubChem CID | 87256327 |
| Molecular Formula | C10H10F8O |
| Molecular Weight | 298.17 g/mol |
| Exact Mass | 298.06 |
| IUPAC Name | 4,5,5,5-tetrafluoro-3-(4,5,5,5-tetrafluoropent-1-en-3-yloxy)pent-1-ene |
| SMILES | C=CC(OC(C=C)C(F)C(F)(F)F)C(F)C(F)(F)F |
| InChI | InChI=1S/C10H10F8O/c1-3-5(7(11)9(13,14)15)19-6(4-2)8(12)10(16,17)18/h3-8H,1-2H2 |
| InChIKey | GZDPUTYGAGJWHU-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.17 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|