About 4-pyren-1-yl-2H-triazole
4-pyren-1-yl-2H-triazole (PubChem CID 87256789) has the molecular formula C18H11N3
and a molecular weight of 269.31 g/mol. Its IUPAC name is 4-pyren-1-yl-2H-triazole.
Molecular Properties
| Compound Name | 4-pyren-1-yl-2H-triazole |
| PubChem CID | 87256789 |
| Molecular Formula | C18H11N3 |
| Molecular Weight | 269.31 g/mol |
| Exact Mass | 269.10 |
| IUPAC Name | 4-pyren-1-yl-2H-triazole |
| SMILES | c1cc2ccc3ccc(-c4cn[nH]n4)c4ccc(c1)c2c34 |
| InChI | InChI=1S/C18H11N3/c1-2-11-4-5-13-6-8-14(16-10-19-21-20-16)15-9-7-12(3-1)17(11)18(13)15/h1-10H,(H,19,20,21) |
| InChIKey | WBRATFYTKXFZOW-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.31 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 4-pyren-1-yl-2H-triazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-pyren-1-yl-2H-triazole?
The IUPAC name of 4-pyren-1-yl-2H-triazole (CID 87256789) is 4-pyren-1-yl-2H-triazole.
What is the SMILES notation for 4-pyren-1-yl-2H-triazole?
The canonical SMILES for 4-pyren-1-yl-2H-triazole is c1cc2ccc3ccc(-c4cn[nH]n4)c4ccc(c1)c2c34.
What is the InChIKey of 4-pyren-1-yl-2H-triazole?
The InChIKey is WBRATFYTKXFZOW-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H11N3/c1-2-11-4-5-13-6-8-14(16-10-19-21-20-16)15-9-7-12(3-1)17(11)18(13)15/h1-10H,(H,19,20,21).
What are the key properties of 4-pyren-1-yl-2H-triazole?
4-pyren-1-yl-2H-triazole has a molecular weight of 269.31 g/mol, XLogP of 4.37, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-pyren-1-yl-2H-triazole is sourced from PubChem (CID 87256789), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).