C39H60Cl2N2OPRu+ — CID 87256901
[1,3-bis(2,4,6-trimethylphenyl)imidazolidin-2-ylidene]-dichloro-(ethoxymethylidene)ruthenium;tricyclopentylphosphanium (PubChem CID 87256901) has the molecular formula C39H60Cl2N2OPRu+ and a molecular weight of 775.87 g/mol. Its IUPAC name is [1,3-bis(2,4,6-trimethylphenyl)imidazolidin-2-ylidene]-dichloro-(ethoxymethylidene)ruthenium;tricyclopentylphosphanium.
| Compound Name | [1,3-bis(2,4,6-trimethylphenyl)imidazolidin-2-ylidene]-dichloro-(ethoxymethylidene)ruthenium;tricyclopentylphosphanium |
|---|---|
| PubChem CID | 87256901 |
| Molecular Formula | C39H60Cl2N2OPRu+ |
| Molecular Weight | 775.87 g/mol |
| Exact Mass | 775.29 |
| IUPAC Name | [1,3-bis(2,4,6-trimethylphenyl)imidazolidin-2-ylidene]-dichloro-(ethoxymethylidene)ruthenium;tricyclopentylphosphanium |
| SMILES | C1CCC([PH+](C2CCCC2)C2CCCC2)C1.CCOC=[Ru](Cl)(Cl)=C1N(c2c(C)cc(C)cc2C)CCN1c1c(C)cc(C)cc1C |
| InChI | InChI=1S/C21H26N2.C15H27P.C3H6O.2ClH.Ru/c1-14-9-16(3)20(17(4)10-14)22-7-8-23(13-22)21-18(5)11-15(2)12-19(21)6;1-2-8-13(7-1)16(14-9-3-4-10-14)15-11-5-6-12-15;1-3-4-2;;;/h9-12H,7-8H2,1-6H3;13-15H,1-12H2;2H,3H2,1H3;2*1H;/q;;;;;+2/p-1 |
| InChIKey | ICNNVSMBIJVFGU-UHFFFAOYSA-M |
| XLogP | 11.24 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 775.87 |
| LogP ≤ 5 | 11.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|