About 3-methylbut-2-en-1-ol;2-methylprop-1-ene
3-methylbut-2-en-1-ol;2-methylprop-1-ene (PubChem CID 87257087) has the molecular formula C9H18O
and a molecular weight of 142.24 g/mol. Its IUPAC name is 3-methylbut-2-en-1-ol;2-methylprop-1-ene.
Molecular Properties
| Compound Name | 3-methylbut-2-en-1-ol;2-methylprop-1-ene |
| PubChem CID | 87257087 |
| Molecular Formula | C9H18O |
| Molecular Weight | 142.24 g/mol |
| Exact Mass | 142.14 |
| IUPAC Name | 3-methylbut-2-en-1-ol;2-methylprop-1-ene |
| SMILES | C=C(C)C.CC(C)=CCO |
| InChI | InChI=1S/C5H10O.C4H8/c1-5(2)3-4-6;1-4(2)3/h3,6H,4H2,1-2H3;1H2,2-3H3 |
| InChIKey | OZNRMZXQBCNHPX-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.24 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-methylbut-2-en-1-ol;2-methylprop-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylbut-2-en-1-ol;2-methylprop-1-ene?
The IUPAC name of 3-methylbut-2-en-1-ol;2-methylprop-1-ene (CID 87257087) is 3-methylbut-2-en-1-ol;2-methylprop-1-ene.
What is the SMILES notation for 3-methylbut-2-en-1-ol;2-methylprop-1-ene?
The canonical SMILES for 3-methylbut-2-en-1-ol;2-methylprop-1-ene is C=C(C)C.CC(C)=CCO.
What is the InChIKey of 3-methylbut-2-en-1-ol;2-methylprop-1-ene?
The InChIKey is OZNRMZXQBCNHPX-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10O.C4H8/c1-5(2)3-4-6;1-4(2)3/h3,6H,4H2,1-2H3;1H2,2-3H3.
What are the key properties of 3-methylbut-2-en-1-ol;2-methylprop-1-ene?
3-methylbut-2-en-1-ol;2-methylprop-1-ene has a molecular weight of 142.24 g/mol, XLogP of 2.53, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylbut-2-en-1-ol;2-methylprop-1-ene is sourced from PubChem (CID 87257087), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).