About 1,1,1-trifluoropentane-2,4-dione;zirconium
1,1,1-trifluoropentane-2,4-dione;zirconium (PubChem CID 87257091) has the molecular formula C5H5F3O2Zr
and a molecular weight of 245.31 g/mol. Its IUPAC name is 1,1,1-trifluoropentane-2,4-dione;zirconium.
Molecular Properties
| Compound Name | 1,1,1-trifluoropentane-2,4-dione;zirconium |
| PubChem CID | 87257091 |
| Molecular Formula | C5H5F3O2Zr |
| Molecular Weight | 245.31 g/mol |
| Exact Mass | 243.93 |
| IUPAC Name | 1,1,1-trifluoropentane-2,4-dione;zirconium |
| SMILES | CC(=O)CC(=O)C(F)(F)F.[Zr] |
| InChI | InChI=1S/C5H5F3O2.Zr/c1-3(9)2-4(10)5(6,7)8;/h2H2,1H3; |
| InChIKey | VGBLZYMKYXNKFS-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.31 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 1,1,1-trifluoropentane-2,4-dione;zirconium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1,1-trifluoropentane-2,4-dione;zirconium?
The IUPAC name of 1,1,1-trifluoropentane-2,4-dione;zirconium (CID 87257091) is 1,1,1-trifluoropentane-2,4-dione;zirconium.
What is the SMILES notation for 1,1,1-trifluoropentane-2,4-dione;zirconium?
The canonical SMILES for 1,1,1-trifluoropentane-2,4-dione;zirconium is CC(=O)CC(=O)C(F)(F)F.[Zr].
What is the InChIKey of 1,1,1-trifluoropentane-2,4-dione;zirconium?
The InChIKey is VGBLZYMKYXNKFS-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5F3O2.Zr/c1-3(9)2-4(10)5(6,7)8;/h2H2,1H3;.
What are the key properties of 1,1,1-trifluoropentane-2,4-dione;zirconium?
1,1,1-trifluoropentane-2,4-dione;zirconium has a molecular weight of 245.31 g/mol, XLogP of 1.09, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1,1-trifluoropentane-2,4-dione;zirconium is sourced from PubChem (CID 87257091), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).