About tert-butyl-hydroxy-dimethylsilane;hept-1-yne
tert-butyl-hydroxy-dimethylsilane;hept-1-yne (PubChem CID 87257109) has the molecular formula C13H28OSi
and a molecular weight of 228.45 g/mol. Its IUPAC name is tert-butyl-hydroxy-dimethylsilane;hept-1-yne.
Molecular Properties
| Compound Name | tert-butyl-hydroxy-dimethylsilane;hept-1-yne |
| PubChem CID | 87257109 |
| Molecular Formula | C13H28OSi |
| Molecular Weight | 228.45 g/mol |
| Exact Mass | 228.19 |
| IUPAC Name | tert-butyl-hydroxy-dimethylsilane;hept-1-yne |
| SMILES | C#CCCCCC.CC(C)(C)[Si](C)(C)O |
| InChI | InChI=1S/C7H12.C6H16OSi/c1-3-5-7-6-4-2;1-6(2,3)8(4,5)7/h1H,4-7H2,2H3;7H,1-5H3 |
| InChIKey | XAJCGDYEDAEUHO-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.45 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl-hydroxy-dimethylsilane;hept-1-yne with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl-hydroxy-dimethylsilane;hept-1-yne?
The IUPAC name of tert-butyl-hydroxy-dimethylsilane;hept-1-yne (CID 87257109) is tert-butyl-hydroxy-dimethylsilane;hept-1-yne.
What is the SMILES notation for tert-butyl-hydroxy-dimethylsilane;hept-1-yne?
The canonical SMILES for tert-butyl-hydroxy-dimethylsilane;hept-1-yne is C#CCCCCC.CC(C)(C)[Si](C)(C)O.
What is the InChIKey of tert-butyl-hydroxy-dimethylsilane;hept-1-yne?
The InChIKey is XAJCGDYEDAEUHO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12.C6H16OSi/c1-3-5-7-6-4-2;1-6(2,3)8(4,5)7/h1H,4-7H2,2H3;7H,1-5H3.
What are the key properties of tert-butyl-hydroxy-dimethylsilane;hept-1-yne?
tert-butyl-hydroxy-dimethylsilane;hept-1-yne has a molecular weight of 228.45 g/mol, XLogP of 4.18, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl-hydroxy-dimethylsilane;hept-1-yne is sourced from PubChem (CID 87257109), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).