C9H16F6OSi2 — CID 87257440
2,2,3,3-tetramethyl-6,6-bis(trifluoromethyl)oxadisilinane (PubChem CID 87257440) has the molecular formula C9H16F6OSi2 and a molecular weight of 310.39 g/mol. Its IUPAC name is 2,2,3,3-tetramethyl-6,6-bis(trifluoromethyl)oxadisilinane.
| Compound Name | 2,2,3,3-tetramethyl-6,6-bis(trifluoromethyl)oxadisilinane |
|---|---|
| PubChem CID | 87257440 |
| Molecular Formula | C9H16F6OSi2 |
| Molecular Weight | 310.39 g/mol |
| Exact Mass | 310.06 |
| IUPAC Name | 2,2,3,3-tetramethyl-6,6-bis(trifluoromethyl)oxadisilinane |
| SMILES | C[Si]1(C)CCC(C(F)(F)F)(C(F)(F)F)O[Si]1(C)C |
| InChI | InChI=1S/C9H16F6OSi2/c1-17(2)6-5-7(8(10,11)12,9(13,14)15)16-18(17,3)4/h5-6H2,1-4H3 |
| InChIKey | UHXUNYWJYFSWNT-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.39 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|