About 6-isocyanato-5,5-di(propan-2-yl)cyclohexa-1,3-diene
6-isocyanato-5,5-di(propan-2-yl)cyclohexa-1,3-diene (PubChem CID 87257657) has the molecular formula C13H19NO
and a molecular weight of 205.30 g/mol. Its IUPAC name is 6-isocyanato-5,5-di(propan-2-yl)cyclohexa-1,3-diene.
Molecular Properties
| Compound Name | 6-isocyanato-5,5-di(propan-2-yl)cyclohexa-1,3-diene |
| PubChem CID | 87257657 |
| Molecular Formula | C13H19NO |
| Molecular Weight | 205.30 g/mol |
| Exact Mass | 205.15 |
| IUPAC Name | 6-isocyanato-5,5-di(propan-2-yl)cyclohexa-1,3-diene |
| SMILES | CC(C)C1(C(C)C)C=CC=CC1N=C=O |
| InChI | InChI=1S/C13H19NO/c1-10(2)13(11(3)4)8-6-5-7-12(13)14-9-15/h5-8,10-12H,1-4H3 |
| InChIKey | QRIVGVPXELHUDR-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.30 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze 6-isocyanato-5,5-di(propan-2-yl)cyclohexa-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-isocyanato-5,5-di(propan-2-yl)cyclohexa-1,3-diene?
The IUPAC name of 6-isocyanato-5,5-di(propan-2-yl)cyclohexa-1,3-diene (CID 87257657) is 6-isocyanato-5,5-di(propan-2-yl)cyclohexa-1,3-diene.
What is the SMILES notation for 6-isocyanato-5,5-di(propan-2-yl)cyclohexa-1,3-diene?
The canonical SMILES for 6-isocyanato-5,5-di(propan-2-yl)cyclohexa-1,3-diene is CC(C)C1(C(C)C)C=CC=CC1N=C=O.
What is the InChIKey of 6-isocyanato-5,5-di(propan-2-yl)cyclohexa-1,3-diene?
The InChIKey is QRIVGVPXELHUDR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19NO/c1-10(2)13(11(3)4)8-6-5-7-12(13)14-9-15/h5-8,10-12H,1-4H3.
What are the key properties of 6-isocyanato-5,5-di(propan-2-yl)cyclohexa-1,3-diene?
6-isocyanato-5,5-di(propan-2-yl)cyclohexa-1,3-diene has a molecular weight of 205.30 g/mol, XLogP of 3.12, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-isocyanato-5,5-di(propan-2-yl)cyclohexa-1,3-diene is sourced from PubChem (CID 87257657), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).