About 2-chloro-1,1,3,3-tetramethylguanidine;hydrochloride
2-chloro-1,1,3,3-tetramethylguanidine;hydrochloride (PubChem CID 87257767) has the molecular formula C5H13Cl2N3
and a molecular weight of 186.09 g/mol. Its IUPAC name is 2-chloro-1,1,3,3-tetramethylguanidine;hydrochloride.
Molecular Properties
| Compound Name | 2-chloro-1,1,3,3-tetramethylguanidine;hydrochloride |
| PubChem CID | 87257767 |
| Molecular Formula | C5H13Cl2N3 |
| Molecular Weight | 186.09 g/mol |
| Exact Mass | 185.05 |
| IUPAC Name | 2-chloro-1,1,3,3-tetramethylguanidine;hydrochloride |
| SMILES | CN(C)C(=NCl)N(C)C.Cl |
| InChI | InChI=1S/C5H12ClN3.ClH/c1-8(2)5(7-6)9(3)4;/h1-4H3;1H |
| InChIKey | LFIRNOXFDKMJCJ-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.09 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-1,1,3,3-tetramethylguanidine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-1,1,3,3-tetramethylguanidine;hydrochloride?
The IUPAC name of 2-chloro-1,1,3,3-tetramethylguanidine;hydrochloride (CID 87257767) is 2-chloro-1,1,3,3-tetramethylguanidine;hydrochloride.
What is the SMILES notation for 2-chloro-1,1,3,3-tetramethylguanidine;hydrochloride?
The canonical SMILES for 2-chloro-1,1,3,3-tetramethylguanidine;hydrochloride is CN(C)C(=NCl)N(C)C.Cl.
What is the InChIKey of 2-chloro-1,1,3,3-tetramethylguanidine;hydrochloride?
The InChIKey is LFIRNOXFDKMJCJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H12ClN3.ClH/c1-8(2)5(7-6)9(3)4;/h1-4H3;1H.
What are the key properties of 2-chloro-1,1,3,3-tetramethylguanidine;hydrochloride?
2-chloro-1,1,3,3-tetramethylguanidine;hydrochloride has a molecular weight of 186.09 g/mol, XLogP of 1.04, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-1,1,3,3-tetramethylguanidine;hydrochloride is sourced from PubChem (CID 87257767), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).