C23H21F3N4O3S2 — CID 87257852
[2-amino-6-[4-[[(3R)-1-azabicyclo[2.2.2]octan-3-yl]oxy]phenyl]-1,3-benzothiazol-4-yl] thiocyanate;2,2,2-trifluoroacetic acid (PubChem CID 87257852) has the molecular formula C23H21F3N4O3S2 and a molecular weight of 522.57 g/mol. Its IUPAC name is [2-amino-6-[4-[[(3R)-1-azabicyclo[2.2.2]octan-3-yl]oxy]phenyl]-1,3-benzothiazol-4-yl] thiocyanate;2,2,2-trifluoroacetic acid.
| Compound Name | [2-amino-6-[4-[[(3R)-1-azabicyclo[2.2.2]octan-3-yl]oxy]phenyl]-1,3-benzothiazol-4-yl] thiocyanate;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 87257852 |
| Molecular Formula | C23H21F3N4O3S2 |
| Molecular Weight | 522.57 g/mol |
| Exact Mass | 522.10 |
| IUPAC Name | [2-amino-6-[4-[[(3R)-1-azabicyclo[2.2.2]octan-3-yl]oxy]phenyl]-1,3-benzothiazol-4-yl] thiocyanate;2,2,2-trifluoroacetic acid |
| SMILES | N#CSc1cc(-c2ccc(O[C@H]3CN4CCC3CC4)cc2)cc2sc(N)nc12.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C21H20N4OS2.C2HF3O2/c22-12-27-18-9-15(10-19-20(18)24-21(23)28-19)13-1-3-16(4-2-13)26-17-11-25-7-5-14(17)6-8-25;3-2(4,5)1(6)7/h1-4,9-10,14,17H,5-8,11H2,(H2,23,24);(H,6,7)/t17-;/m0./s1 |
| InChIKey | BOLFOJFQKQXTOD-LMOVPXPDSA-N |
| XLogP | 5.22 |
| TPSA | 112.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.57 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|