C20H18ClN5O2S — CID 87257973
[5-(3-chlorophenyl)-1,2,4-oxadiazol-3-yl]-[4-ethyl-5-(4-methoxyphenyl)-1,2,4-triazol-3-yl]methanethiol (PubChem CID 87257973) has the molecular formula C20H18ClN5O2S and a molecular weight of 427.92 g/mol. Its IUPAC name is [5-(3-chlorophenyl)-1,2,4-oxadiazol-3-yl]-[4-ethyl-5-(4-methoxyphenyl)-1,2,4-triazol-3-yl]methanethiol.
| Compound Name | [5-(3-chlorophenyl)-1,2,4-oxadiazol-3-yl]-[4-ethyl-5-(4-methoxyphenyl)-1,2,4-triazol-3-yl]methanethiol |
|---|---|
| PubChem CID | 87257973 |
| Molecular Formula | C20H18ClN5O2S |
| Molecular Weight | 427.92 g/mol |
| Exact Mass | 427.09 |
| IUPAC Name | [5-(3-chlorophenyl)-1,2,4-oxadiazol-3-yl]-[4-ethyl-5-(4-methoxyphenyl)-1,2,4-triazol-3-yl]methanethiol |
| SMILES | CCn1c(-c2ccc(OC)cc2)nnc1C(S)c1noc(-c2cccc(Cl)c2)n1 |
| InChI | InChI=1S/C20H18ClN5O2S/c1-3-26-18(12-7-9-15(27-2)10-8-12)23-24-19(26)16(29)17-22-20(28-25-17)13-5-4-6-14(21)11-13/h4-11,16,29H,3H2,1-2H3 |
| InChIKey | KNRYHQVRJMVSAY-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 78.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.92 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|