C30H33N3O5 — CID 87258260
(E)-3-[1'-[1-(1H-indol-3-yl)ethyl]-4-oxospiro[3H-chromene-2,3'-pyrrolidine]-6-yl]-N-(oxan-2-yloxy)prop-2-enamide (PubChem CID 87258260) has the molecular formula C30H33N3O5 and a molecular weight of 515.61 g/mol. Its IUPAC name is (E)-3-[1'-[1-(1H-indol-3-yl)ethyl]-4-oxospiro[3H-chromene-2,3'-pyrrolidine]-6-yl]-N-(oxan-2-yloxy)prop-2-enamide.
| Compound Name | (E)-3-[1'-[1-(1H-indol-3-yl)ethyl]-4-oxospiro[3H-chromene-2,3'-pyrrolidine]-6-yl]-N-(oxan-2-yloxy)prop-2-enamide |
|---|---|
| PubChem CID | 87258260 |
| Molecular Formula | C30H33N3O5 |
| Molecular Weight | 515.61 g/mol |
| Exact Mass | 515.24 |
| IUPAC Name | (E)-3-[1'-[1-(1H-indol-3-yl)ethyl]-4-oxospiro[3H-chromene-2,3'-pyrrolidine]-6-yl]-N-(oxan-2-yloxy)prop-2-enamide |
| SMILES | CC(c1c[nH]c2ccccc12)N1CCC2(CC(=O)c3cc(/C=C/C(=O)NOC4CCCCO4)ccc3O2)C1 |
| InChI | InChI=1S/C30H33N3O5/c1-20(24-18-31-25-7-3-2-6-22(24)25)33-14-13-30(19-33)17-26(34)23-16-21(9-11-27(23)37-30)10-12-28(35)32-38-29-8-4-5-15-36-29/h2-3,6-7,9-12,16,18,20,29,31H,4-5,8,13-15,17,19H2,1H3,(H,32,35)/b12-10+ |
| InChIKey | JCTBZHQUYXQAHO-ZRDIBKRKSA-N |
| XLogP | 4.93 |
| TPSA | 92.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.61 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|