C10H7F11O2 — CID 87259134
5,5,6,6,7,8,8,8-octafluoro-2-methylidene-7-(trifluoromethyl)octanoic acid (PubChem CID 87259134) has the molecular formula C10H7F11O2 and a molecular weight of 368.14 g/mol. Its IUPAC name is 5,5,6,6,7,8,8,8-octafluoro-2-methylidene-7-(trifluoromethyl)octanoic acid.
| Compound Name | 5,5,6,6,7,8,8,8-octafluoro-2-methylidene-7-(trifluoromethyl)octanoic acid |
|---|---|
| PubChem CID | 87259134 |
| Molecular Formula | C10H7F11O2 |
| Molecular Weight | 368.14 g/mol |
| Exact Mass | 368.03 |
| IUPAC Name | 5,5,6,6,7,8,8,8-octafluoro-2-methylidene-7-(trifluoromethyl)octanoic acid |
| SMILES | C=C(CCC(F)(F)C(F)(F)C(F)(C(F)(F)F)C(F)(F)F)C(=O)O |
| InChI | InChI=1S/C10H7F11O2/c1-4(5(22)23)2-3-6(11,12)8(14,15)7(13,9(16,17)18)10(19,20)21/h1-3H2,(H,22,23) |
| InChIKey | COBKSULLWJBQGR-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.14 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|