C21H24F3N3O — CID 87259729
2,4-ditert-butyl-6-(4,5,7-trifluoro-6-methylbenzotriazol-2-yl)phenol (PubChem CID 87259729) has the molecular formula C21H24F3N3O and a molecular weight of 391.44 g/mol. Its IUPAC name is 2,4-ditert-butyl-6-(4,5,7-trifluoro-6-methylbenzotriazol-2-yl)phenol.
| Compound Name | 2,4-ditert-butyl-6-(4,5,7-trifluoro-6-methylbenzotriazol-2-yl)phenol |
|---|---|
| PubChem CID | 87259729 |
| Molecular Formula | C21H24F3N3O |
| Molecular Weight | 391.44 g/mol |
| Exact Mass | 391.19 |
| IUPAC Name | 2,4-ditert-butyl-6-(4,5,7-trifluoro-6-methylbenzotriazol-2-yl)phenol |
| SMILES | Cc1c(F)c(F)c2nn(-c3cc(C(C)(C)C)cc(C(C)(C)C)c3O)nc2c1F |
| InChI | InChI=1S/C21H24F3N3O/c1-10-14(22)16(24)18-17(15(10)23)25-27(26-18)13-9-11(20(2,3)4)8-12(19(13)28)21(5,6)7/h8-9,28H,1-7H3 |
| InChIKey | OCKVHKIOSNYKAG-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.44 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|