C18H19NO2 — CID 87259774
2,5-dimethyl-3,4-diphenyl-1,2-oxazolidine-4-carbaldehyde (PubChem CID 87259774) has the molecular formula C18H19NO2 and a molecular weight of 281.36 g/mol. Its IUPAC name is 2,5-dimethyl-3,4-diphenyl-1,2-oxazolidine-4-carbaldehyde.
| Compound Name | 2,5-dimethyl-3,4-diphenyl-1,2-oxazolidine-4-carbaldehyde |
|---|---|
| PubChem CID | 87259774 |
| Molecular Formula | C18H19NO2 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | 2,5-dimethyl-3,4-diphenyl-1,2-oxazolidine-4-carbaldehyde |
| SMILES | CC1ON(C)C(c2ccccc2)C1(C=O)c1ccccc1 |
| InChI | InChI=1S/C18H19NO2/c1-14-18(13-20,16-11-7-4-8-12-16)17(19(2)21-14)15-9-5-3-6-10-15/h3-14,17H,1-2H3 |
| InChIKey | KZDUBSQHKUDIBG-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|