C48H42F9N9O6S3 — CID 87259798
2-[[3-methyl-4-(2,2,2-trifluoroethoxy)-2-pyridinyl]methylsulfinyl]-1H-benzimidazole (PubChem CID 87259798) has the molecular formula C48H42F9N9O6S3 and a molecular weight of 1108.10 g/mol. Its IUPAC name is 2-[[3-methyl-4-(2,2,2-trifluoroethoxy)-2-pyridinyl]methylsulfinyl]-1H-benzimidazole.
| Compound Name | 2-[[3-methyl-4-(2,2,2-trifluoroethoxy)-2-pyridinyl]methylsulfinyl]-1H-benzimidazole |
|---|---|
| PubChem CID | 87259798 |
| Molecular Formula | C48H42F9N9O6S3 |
| Molecular Weight | 1108.10 g/mol |
| Exact Mass | 1107.23 |
| IUPAC Name | 2-[[3-methyl-4-(2,2,2-trifluoroethoxy)-2-pyridinyl]methylsulfinyl]-1H-benzimidazole |
| SMILES | Cc1c(OCC(F)(F)F)ccnc1CS(=O)c1nc2ccccc2[nH]1.Cc1c(OCC(F)(F)F)ccnc1CS(=O)c1nc2ccccc2[nH]1.Cc1c(OCC(F)(F)F)ccnc1CS(=O)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/3C16H14F3N3O2S/c3*1-10-13(20-7-6-14(10)24-9-16(17,18)19)8-25(23)15-21-11-4-2-3-5-12(11)22-15/h3*2-7H,8-9H2,1H3,(H,21,22) |
| InChIKey | YMENDMRRJWRLGF-UHFFFAOYSA-N |
| XLogP | 10.55 |
| TPSA | 203.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 75 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1108.10 |
| LogP ≤ 5 | 10.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |