About [2-(3-chlorophenyl)-2,2-difluoroethyl] trifluoromethanesulfonate
[2-(3-chlorophenyl)-2,2-difluoroethyl] trifluoromethanesulfonate (PubChem CID 87259950) has the molecular formula C9H6ClF5O3S
and a molecular weight of 324.65 g/mol. Its IUPAC name is [2-(3-chlorophenyl)-2,2-difluoroethyl] trifluoromethanesulfonate.
Molecular Properties
| Compound Name | [2-(3-chlorophenyl)-2,2-difluoroethyl] trifluoromethanesulfonate |
| PubChem CID | 87259950 |
| Molecular Formula | C9H6ClF5O3S |
| Molecular Weight | 324.65 g/mol |
| Exact Mass | 323.96 |
| IUPAC Name | [2-(3-chlorophenyl)-2,2-difluoroethyl] trifluoromethanesulfonate |
| SMILES | O=S(=O)(OCC(F)(F)c1cccc(Cl)c1)C(F)(F)F |
| InChI | InChI=1S/C9H6ClF5O3S/c10-7-3-1-2-6(4-7)8(11,12)5-18-19(16,17)9(13,14)15/h1-4H,5H2 |
| InChIKey | YITYTULHXROTLU-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.65 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze [2-(3-chlorophenyl)-2,2-difluoroethyl] trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(3-chlorophenyl)-2,2-difluoroethyl] trifluoromethanesulfonate?
The IUPAC name of [2-(3-chlorophenyl)-2,2-difluoroethyl] trifluoromethanesulfonate (CID 87259950) is [2-(3-chlorophenyl)-2,2-difluoroethyl] trifluoromethanesulfonate.
What is the SMILES notation for [2-(3-chlorophenyl)-2,2-difluoroethyl] trifluoromethanesulfonate?
The canonical SMILES for [2-(3-chlorophenyl)-2,2-difluoroethyl] trifluoromethanesulfonate is O=S(=O)(OCC(F)(F)c1cccc(Cl)c1)C(F)(F)F.
What is the InChIKey of [2-(3-chlorophenyl)-2,2-difluoroethyl] trifluoromethanesulfonate?
The InChIKey is YITYTULHXROTLU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6ClF5O3S/c10-7-3-1-2-6(4-7)8(11,12)5-18-19(16,17)9(13,14)15/h1-4H,5H2.
What are the key properties of [2-(3-chlorophenyl)-2,2-difluoroethyl] trifluoromethanesulfonate?
[2-(3-chlorophenyl)-2,2-difluoroethyl] trifluoromethanesulfonate has a molecular weight of 324.65 g/mol, XLogP of 3.30, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(3-chlorophenyl)-2,2-difluoroethyl] trifluoromethanesulfonate is sourced from PubChem (CID 87259950), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).