C26H28O5 — CID 87260033
(2S,3R,4S)-4-hydroxy-2,3,5-tris(phenylmethoxy)pentanal (PubChem CID 87260033) has the molecular formula C26H28O5 and a molecular weight of 420.50 g/mol. Its IUPAC name is (2S,3R,4S)-4-hydroxy-2,3,5-tris(phenylmethoxy)pentanal.
| Compound Name | (2S,3R,4S)-4-hydroxy-2,3,5-tris(phenylmethoxy)pentanal |
|---|---|
| PubChem CID | 87260033 |
| Molecular Formula | C26H28O5 |
| Molecular Weight | 420.50 g/mol |
| Exact Mass | 420.19 |
| IUPAC Name | (2S,3R,4S)-4-hydroxy-2,3,5-tris(phenylmethoxy)pentanal |
| SMILES | O=C[C@@H](OCc1ccccc1)[C@H](OCc1ccccc1)[C@@H](O)COCc1ccccc1 |
| InChI | InChI=1S/C26H28O5/c27-16-25(30-18-22-12-6-2-7-13-22)26(31-19-23-14-8-3-9-15-23)24(28)20-29-17-21-10-4-1-5-11-21/h1-16,24-26,28H,17-20H2/t24-,25+,26+/m0/s1 |
| InChIKey | XUCNSIRQCBFBHF-JIMJEQGWSA-N |
| XLogP | 3.93 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.50 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|