About 6-(4,6-dichloro-1,3,5-triazin-2-yl)hexan-1-amine
6-(4,6-dichloro-1,3,5-triazin-2-yl)hexan-1-amine (PubChem CID 87260113) has the molecular formula C9H14Cl2N4
and a molecular weight of 249.14 g/mol. Its IUPAC name is 6-(4,6-dichloro-1,3,5-triazin-2-yl)hexan-1-amine.
Molecular Properties
| Compound Name | 6-(4,6-dichloro-1,3,5-triazin-2-yl)hexan-1-amine |
| PubChem CID | 87260113 |
| Molecular Formula | C9H14Cl2N4 |
| Molecular Weight | 249.14 g/mol |
| Exact Mass | 248.06 |
| IUPAC Name | 6-(4,6-dichloro-1,3,5-triazin-2-yl)hexan-1-amine |
| SMILES | NCCCCCCc1nc(Cl)nc(Cl)n1 |
| InChI | InChI=1S/C9H14Cl2N4/c10-8-13-7(14-9(11)15-8)5-3-1-2-4-6-12/h1-6,12H2 |
| InChIKey | AZTRWASTBSRKOL-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 64.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.14 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-(4,6-dichloro-1,3,5-triazin-2-yl)hexan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(4,6-dichloro-1,3,5-triazin-2-yl)hexan-1-amine?
The IUPAC name of 6-(4,6-dichloro-1,3,5-triazin-2-yl)hexan-1-amine (CID 87260113) is 6-(4,6-dichloro-1,3,5-triazin-2-yl)hexan-1-amine.
What is the SMILES notation for 6-(4,6-dichloro-1,3,5-triazin-2-yl)hexan-1-amine?
The canonical SMILES for 6-(4,6-dichloro-1,3,5-triazin-2-yl)hexan-1-amine is NCCCCCCc1nc(Cl)nc(Cl)n1.
What is the InChIKey of 6-(4,6-dichloro-1,3,5-triazin-2-yl)hexan-1-amine?
The InChIKey is AZTRWASTBSRKOL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14Cl2N4/c10-8-13-7(14-9(11)15-8)5-3-1-2-4-6-12/h1-6,12H2.
What are the key properties of 6-(4,6-dichloro-1,3,5-triazin-2-yl)hexan-1-amine?
6-(4,6-dichloro-1,3,5-triazin-2-yl)hexan-1-amine has a molecular weight of 249.14 g/mol, XLogP of 2.24, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(4,6-dichloro-1,3,5-triazin-2-yl)hexan-1-amine is sourced from PubChem (CID 87260113), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).