C14H17ClN6O2 — CID 87260160
3-[[4-(benzylamino)-6-chloro-1,3,5-triazin-2-yl]amino]propyl carbamate (PubChem CID 87260160) has the molecular formula C14H17ClN6O2 and a molecular weight of 336.78 g/mol. Its IUPAC name is 3-[[4-(benzylamino)-6-chloro-1,3,5-triazin-2-yl]amino]propyl carbamate.
| Compound Name | 3-[[4-(benzylamino)-6-chloro-1,3,5-triazin-2-yl]amino]propyl carbamate |
|---|---|
| PubChem CID | 87260160 |
| Molecular Formula | C14H17ClN6O2 |
| Molecular Weight | 336.78 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | 3-[[4-(benzylamino)-6-chloro-1,3,5-triazin-2-yl]amino]propyl carbamate |
| SMILES | NC(=O)OCCCNc1nc(Cl)nc(NCc2ccccc2)n1 |
| InChI | InChI=1S/C14H17ClN6O2/c15-11-19-13(17-7-4-8-23-12(16)22)21-14(20-11)18-9-10-5-2-1-3-6-10/h1-3,5-6H,4,7-9H2,(H2,16,22)(H2,17,18,19,20,21) |
| InChIKey | KIFJBKVKERWBHS-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 115.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.78 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|