About 1-[3-[bis(triphenylsilyl)amino]propyl]pyrrole-2,5-dione
1-[3-[bis(triphenylsilyl)amino]propyl]pyrrole-2,5-dione (PubChem CID 87260783) has the molecular formula C43H38N2O2Si2
and a molecular weight of 670.96 g/mol. Its IUPAC name is 1-[3-[bis(triphenylsilyl)amino]propyl]pyrrole-2,5-dione.
Molecular Properties
| Compound Name | 1-[3-[bis(triphenylsilyl)amino]propyl]pyrrole-2,5-dione |
| PubChem CID | 87260783 |
| Molecular Formula | C43H38N2O2Si2 |
| Molecular Weight | 670.96 g/mol |
| Exact Mass | 670.25 |
| IUPAC Name | 1-[3-[bis(triphenylsilyl)amino]propyl]pyrrole-2,5-dione |
| SMILES | O=C1C=CC(=O)N1CCCN([Si](c1ccccc1)(c1ccccc1)c1ccccc1)[Si](c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C43H38N2O2Si2/c46-42-32-33-43(47)44(42)34-19-35-45(48(36-20-7-1-8-21-36,37-22-9-2-10-23-37)38-24-11-3-12-25-38)49(39-26-13-4-14-27-39,40-28-15-5-16-29-40)41-30-17-6-18-31-41/h1-18,20-33H,19,34-35H2 |
| InChIKey | CEAPMJBZNYHYDZ-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 670.96 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze 1-[3-[bis(triphenylsilyl)amino]propyl]pyrrole-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3-[bis(triphenylsilyl)amino]propyl]pyrrole-2,5-dione?
The IUPAC name of 1-[3-[bis(triphenylsilyl)amino]propyl]pyrrole-2,5-dione (CID 87260783) is 1-[3-[bis(triphenylsilyl)amino]propyl]pyrrole-2,5-dione.
What is the SMILES notation for 1-[3-[bis(triphenylsilyl)amino]propyl]pyrrole-2,5-dione?
The canonical SMILES for 1-[3-[bis(triphenylsilyl)amino]propyl]pyrrole-2,5-dione is O=C1C=CC(=O)N1CCCN([Si](c1ccccc1)(c1ccccc1)c1ccccc1)[Si](c1ccccc1)(c1ccccc1)c1ccccc1.
What is the InChIKey of 1-[3-[bis(triphenylsilyl)amino]propyl]pyrrole-2,5-dione?
The InChIKey is CEAPMJBZNYHYDZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C43H38N2O2Si2/c46-42-32-33-43(47)44(42)34-19-35-45(48(36-20-7-1-8-21-36,37-22-9-2-10-23-37)38-24-11-3-12-25-38)49(39-26-13-4-14-27-39,40-28-15-5-16-29-40)41-30-17-6-18-31-41/h1-18,20-33H,19,34-35H2.
What are the key properties of 1-[3-[bis(triphenylsilyl)amino]propyl]pyrrole-2,5-dione?
1-[3-[bis(triphenylsilyl)amino]propyl]pyrrole-2,5-dione has a molecular weight of 670.96 g/mol, XLogP of 3.94, 12 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3-[bis(triphenylsilyl)amino]propyl]pyrrole-2,5-dione is sourced from PubChem (CID 87260783), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).