C13H10O6 — CID 87261277
2,4-bis(oxomethylidene)-6-pentanoylcyclohexane-1,3,5-trione (PubChem CID 87261277) has the molecular formula C13H10O6 and a molecular weight of 262.22 g/mol. Its IUPAC name is 2,4-bis(oxomethylidene)-6-pentanoylcyclohexane-1,3,5-trione.
| Compound Name | 2,4-bis(oxomethylidene)-6-pentanoylcyclohexane-1,3,5-trione |
|---|---|
| PubChem CID | 87261277 |
| Molecular Formula | C13H10O6 |
| Molecular Weight | 262.22 g/mol |
| Exact Mass | 262.05 |
| IUPAC Name | 2,4-bis(oxomethylidene)-6-pentanoylcyclohexane-1,3,5-trione |
| SMILES | CCCCC(=O)C1C(=O)C(=C=O)C(=O)C(=C=O)C1=O |
| InChI | InChI=1S/C13H10O6/c1-2-3-4-9(16)10-12(18)7(5-14)11(17)8(6-15)13(10)19/h10H,2-4H2,1H3 |
| InChIKey | OMFNLWBXUXMXIN-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 102.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.22 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'ketene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|