About (6-chloro-4-methyl-1H-pyrazolo[5,4-b]pyridin-3-yl) 4-(trifluoromethyl)piperidine-1-carboxylate
(6-chloro-4-methyl-1H-pyrazolo[5,4-b]pyridin-3-yl) 4-(trifluoromethyl)piperidine-1-carboxylate (PubChem CID 87261305) has the molecular formula C14H14ClF3N4O2
and a molecular weight of 362.74 g/mol. Its IUPAC name is (6-chloro-4-methyl-1H-pyrazolo[5,4-b]pyridin-3-yl) 4-(trifluoromethyl)piperidine-1-carboxylate.
Molecular Properties
| Compound Name | (6-chloro-4-methyl-1H-pyrazolo[5,4-b]pyridin-3-yl) 4-(trifluoromethyl)piperidine-1-carboxylate |
| PubChem CID | 87261305 |
| Molecular Formula | C14H14ClF3N4O2 |
| Molecular Weight | 362.74 g/mol |
| Exact Mass | 362.08 |
| IUPAC Name | (6-chloro-4-methyl-1H-pyrazolo[5,4-b]pyridin-3-yl) 4-(trifluoromethyl)piperidine-1-carboxylate |
| SMILES | Cc1cc(Cl)nc2[nH]nc(OC(=O)N3CCC(C(F)(F)F)CC3)c12 |
| InChI | InChI=1S/C14H14ClF3N4O2/c1-7-6-9(15)19-11-10(7)12(21-20-11)24-13(23)22-4-2-8(3-5-22)14(16,17)18/h6,8H,2-5H2,1H3,(H,19,20,21) |
| InChIKey | SUGTYTXIZKABMQ-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.74 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze (6-chloro-4-methyl-1H-pyrazolo[5,4-b]pyridin-3-yl) 4-(trifluoromethyl)piperidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-chloro-4-methyl-1H-pyrazolo[5,4-b]pyridin-3-yl) 4-(trifluoromethyl)piperidine-1-carboxylate?
The IUPAC name of (6-chloro-4-methyl-1H-pyrazolo[5,4-b]pyridin-3-yl) 4-(trifluoromethyl)piperidine-1-carboxylate (CID 87261305) is (6-chloro-4-methyl-1H-pyrazolo[5,4-b]pyridin-3-yl) 4-(trifluoromethyl)piperidine-1-carboxylate.
What is the SMILES notation for (6-chloro-4-methyl-1H-pyrazolo[5,4-b]pyridin-3-yl) 4-(trifluoromethyl)piperidine-1-carboxylate?
The canonical SMILES for (6-chloro-4-methyl-1H-pyrazolo[5,4-b]pyridin-3-yl) 4-(trifluoromethyl)piperidine-1-carboxylate is Cc1cc(Cl)nc2[nH]nc(OC(=O)N3CCC(C(F)(F)F)CC3)c12.
What is the InChIKey of (6-chloro-4-methyl-1H-pyrazolo[5,4-b]pyridin-3-yl) 4-(trifluoromethyl)piperidine-1-carboxylate?
The InChIKey is SUGTYTXIZKABMQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14ClF3N4O2/c1-7-6-9(15)19-11-10(7)12(21-20-11)24-13(23)22-4-2-8(3-5-22)14(16,17)18/h6,8H,2-5H2,1H3,(H,19,20,21).
What are the key properties of (6-chloro-4-methyl-1H-pyrazolo[5,4-b]pyridin-3-yl) 4-(trifluoromethyl)piperidine-1-carboxylate?
(6-chloro-4-methyl-1H-pyrazolo[5,4-b]pyridin-3-yl) 4-(trifluoromethyl)piperidine-1-carboxylate has a molecular weight of 362.74 g/mol, XLogP of 3.69, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (6-chloro-4-methyl-1H-pyrazolo[5,4-b]pyridin-3-yl) 4-(trifluoromethyl)piperidine-1-carboxylate is sourced from PubChem (CID 87261305), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).