C13H13ClF2N4O2 — CID 87261350
(6-chloro-4-methyl-1H-pyrazolo[5,4-b]pyridin-3-yl) 4,4-difluoropiperidine-1-carboxylate (PubChem CID 87261350) has the molecular formula C13H13ClF2N4O2 and a molecular weight of 330.72 g/mol. Its IUPAC name is (6-chloro-4-methyl-1H-pyrazolo[5,4-b]pyridin-3-yl) 4,4-difluoropiperidine-1-carboxylate.
| Compound Name | (6-chloro-4-methyl-1H-pyrazolo[5,4-b]pyridin-3-yl) 4,4-difluoropiperidine-1-carboxylate |
|---|---|
| PubChem CID | 87261350 |
| Molecular Formula | C13H13ClF2N4O2 |
| Molecular Weight | 330.72 g/mol |
| Exact Mass | 330.07 |
| IUPAC Name | (6-chloro-4-methyl-1H-pyrazolo[5,4-b]pyridin-3-yl) 4,4-difluoropiperidine-1-carboxylate |
| SMILES | Cc1cc(Cl)nc2[nH]nc(OC(=O)N3CCC(F)(F)CC3)c12 |
| InChI | InChI=1S/C13H13ClF2N4O2/c1-7-6-8(14)17-10-9(7)11(19-18-10)22-12(21)20-4-2-13(15,16)3-5-20/h6H,2-5H2,1H3,(H,17,18,19) |
| InChIKey | AXMOBMUNSQYRAJ-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.72 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|