C25H48O9Si — CID 87261792
dimethyl (2S,3S)-2-[(3R,4R)-4-[(1S)-1-[tert-butyl(dimethyl)silyl]oxyoctyl]-5,5-dimethyldioxolan-3-yl]-2,3-dihydroxybutanedioate (PubChem CID 87261792) has the molecular formula C25H48O9Si and a molecular weight of 520.74 g/mol. Its IUPAC name is dimethyl (2S,3S)-2-[(3R,4R)-4-[(1S)-1-[tert-butyl(dimethyl)silyl]oxyoctyl]-5,5-dimethyldioxolan-3-yl]-2,3-dihydroxybutanedioate.
| Compound Name | dimethyl (2S,3S)-2-[(3R,4R)-4-[(1S)-1-[tert-butyl(dimethyl)silyl]oxyoctyl]-5,5-dimethyldioxolan-3-yl]-2,3-dihydroxybutanedioate |
|---|---|
| PubChem CID | 87261792 |
| Molecular Formula | C25H48O9Si |
| Molecular Weight | 520.74 g/mol |
| Exact Mass | 520.31 |
| IUPAC Name | dimethyl (2S,3S)-2-[(3R,4R)-4-[(1S)-1-[tert-butyl(dimethyl)silyl]oxyoctyl]-5,5-dimethyldioxolan-3-yl]-2,3-dihydroxybutanedioate |
| SMILES | CCCCCCC[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1[C@H]([C@](O)(C(=O)OC)[C@H](O)C(=O)OC)OOC1(C)C |
| InChI | InChI=1S/C25H48O9Si/c1-11-12-13-14-15-16-17(33-35(9,10)23(2,3)4)18-20(32-34-24(18,5)6)25(29,22(28)31-8)19(26)21(27)30-7/h17-20,26,29H,11-16H2,1-10H3/t17-,18-,19+,20+,25-/m0/s1 |
| InChIKey | DWPIUULSNSYJKE-RAKGEHAVSA-N |
| XLogP | 3.90 |
| TPSA | 120.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.74 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|