C16H18FN3O2S — CID 87262202
(5E)-5-[[2-[(3S)-3-(dimethylamino)pyrrolidin-1-yl]-5-fluorophenyl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 87262202) has the molecular formula C16H18FN3O2S and a molecular weight of 335.40 g/mol. Its IUPAC name is (5E)-5-[[2-[(3S)-3-(dimethylamino)pyrrolidin-1-yl]-5-fluorophenyl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-5-[[2-[(3S)-3-(dimethylamino)pyrrolidin-1-yl]-5-fluorophenyl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 87262202 |
| Molecular Formula | C16H18FN3O2S |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.11 |
| IUPAC Name | (5E)-5-[[2-[(3S)-3-(dimethylamino)pyrrolidin-1-yl]-5-fluorophenyl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | CN(C)[C@H]1CCN(c2ccc(F)cc2/C=C2/SC(=O)NC2=O)C1 |
| InChI | InChI=1S/C16H18FN3O2S/c1-19(2)12-5-6-20(9-12)13-4-3-11(17)7-10(13)8-14-15(21)18-16(22)23-14/h3-4,7-8,12H,5-6,9H2,1-2H3,(H,18,21,22)/b14-8+/t12-/m0/s1 |
| InChIKey | ZBFCRJCZTNEIOW-ACLQVGRQSA-N |
| XLogP | 2.29 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|