About 3-ethyl-5-(4-ethylphenyl)-1-(4-nitrophenyl)piperidin-1-ium-1,3-dicarboxylic acid
3-ethyl-5-(4-ethylphenyl)-1-(4-nitrophenyl)piperidin-1-ium-1,3-dicarboxylic acid (PubChem CID 87262229) has the molecular formula C23H27N2O6+
and a molecular weight of 427.48 g/mol. Its IUPAC name is 3-ethyl-5-(4-ethylphenyl)-1-(4-nitrophenyl)piperidin-1-ium-1,3-dicarboxylic acid.
Molecular Properties
| Compound Name | 3-ethyl-5-(4-ethylphenyl)-1-(4-nitrophenyl)piperidin-1-ium-1,3-dicarboxylic acid |
| PubChem CID | 87262229 |
| Molecular Formula | C23H27N2O6+ |
| Molecular Weight | 427.48 g/mol |
| Exact Mass | 427.19 |
| IUPAC Name | 3-ethyl-5-(4-ethylphenyl)-1-(4-nitrophenyl)piperidin-1-ium-1,3-dicarboxylic acid |
| SMILES | CCc1ccc(C2CC(CC)(C(=O)O)C[N+](C(=O)O)(c3ccc([N+](=O)[O-])cc3)C2)cc1 |
| InChI | InChI=1S/C23H26N2O6/c1-3-16-5-7-17(8-6-16)18-13-23(4-2,21(26)27)15-25(14-18,22(28)29)20-11-9-19(10-12-20)24(30)31/h5-12,18H,3-4,13-15H2,1-2H3,(H-,26,27,28,29)/p+1 |
| InChIKey | LYHPEERDMRDJNL-UHFFFAOYSA-O |
| XLogP | 4.81 |
| TPSA | 117.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 427.48 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 3-ethyl-5-(4-ethylphenyl)-1-(4-nitrophenyl)piperidin-1-ium-1,3-dicarboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-5-(4-ethylphenyl)-1-(4-nitrophenyl)piperidin-1-ium-1,3-dicarboxylic acid?
The IUPAC name of 3-ethyl-5-(4-ethylphenyl)-1-(4-nitrophenyl)piperidin-1-ium-1,3-dicarboxylic acid (CID 87262229) is 3-ethyl-5-(4-ethylphenyl)-1-(4-nitrophenyl)piperidin-1-ium-1,3-dicarboxylic acid.
What is the SMILES notation for 3-ethyl-5-(4-ethylphenyl)-1-(4-nitrophenyl)piperidin-1-ium-1,3-dicarboxylic acid?
The canonical SMILES for 3-ethyl-5-(4-ethylphenyl)-1-(4-nitrophenyl)piperidin-1-ium-1,3-dicarboxylic acid is CCc1ccc(C2CC(CC)(C(=O)O)C[N+](C(=O)O)(c3ccc([N+](=O)[O-])cc3)C2)cc1.
What is the InChIKey of 3-ethyl-5-(4-ethylphenyl)-1-(4-nitrophenyl)piperidin-1-ium-1,3-dicarboxylic acid?
The InChIKey is LYHPEERDMRDJNL-UHFFFAOYSA-O. The full InChI is InChI=1S/C23H26N2O6/c1-3-16-5-7-17(8-6-16)18-13-23(4-2,21(26)27)15-25(14-18,22(28)29)20-11-9-19(10-12-20)24(30)31/h5-12,18H,3-4,13-15H2,1-2H3,(H-,26,27,28,29)/p+1.
What are the key properties of 3-ethyl-5-(4-ethylphenyl)-1-(4-nitrophenyl)piperidin-1-ium-1,3-dicarboxylic acid?
3-ethyl-5-(4-ethylphenyl)-1-(4-nitrophenyl)piperidin-1-ium-1,3-dicarboxylic acid has a molecular weight of 427.48 g/mol, XLogP of 4.81, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-5-(4-ethylphenyl)-1-(4-nitrophenyl)piperidin-1-ium-1,3-dicarboxylic acid is sourced from PubChem (CID 87262229), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).