C18H21F3N4O2S — CID 87262513
(5Z)-5-[[2-[3-(3-aminopropylamino)pyrrolidin-1-yl]-5-(trifluoromethyl)phenyl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 87262513) has the molecular formula C18H21F3N4O2S and a molecular weight of 414.45 g/mol. Its IUPAC name is (5Z)-5-[[2-[3-(3-aminopropylamino)pyrrolidin-1-yl]-5-(trifluoromethyl)phenyl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[[2-[3-(3-aminopropylamino)pyrrolidin-1-yl]-5-(trifluoromethyl)phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 87262513 |
| Molecular Formula | C18H21F3N4O2S |
| Molecular Weight | 414.45 g/mol |
| Exact Mass | 414.13 |
| IUPAC Name | (5Z)-5-[[2-[3-(3-aminopropylamino)pyrrolidin-1-yl]-5-(trifluoromethyl)phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | NCCCNC1CCN(c2ccc(C(F)(F)F)cc2/C=C2\SC(=O)NC2=O)C1 |
| InChI | InChI=1S/C18H21F3N4O2S/c19-18(20,21)12-2-3-14(25-7-4-13(10-25)23-6-1-5-22)11(8-12)9-15-16(26)24-17(27)28-15/h2-3,8-9,13,23H,1,4-7,10,22H2,(H,24,26,27)/b15-9- |
| InChIKey | AAILAQAKZGXUBW-DHDCSXOGSA-N |
| XLogP | 2.55 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.45 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|