C13H15N2OS+ — CID 872627
(3R)-10-prop-2-enyl-3,4-dihydro-2H-[1,3]thiazino[3,2-a]benzimidazol-5-ium-3-ol (PubChem CID 872627) has the molecular formula C13H15N2OS+ and a molecular weight of 247.34 g/mol. Its IUPAC name is (3R)-10-prop-2-enyl-3,4-dihydro-2H-[1,3]thiazino[3,2-a]benzimidazol-5-ium-3-ol.
| Compound Name | (3R)-10-prop-2-enyl-3,4-dihydro-2H-[1,3]thiazino[3,2-a]benzimidazol-5-ium-3-ol |
|---|---|
| PubChem CID | 872627 |
| Molecular Formula | C13H15N2OS+ |
| Molecular Weight | 247.34 g/mol |
| Exact Mass | 247.09 |
| IUPAC Name | (3R)-10-prop-2-enyl-3,4-dihydro-2H-[1,3]thiazino[3,2-a]benzimidazol-5-ium-3-ol |
| SMILES | C=CCn1c2[n+](c3ccccc31)C[C@@H](O)CS2 |
| InChI | InChI=1S/C13H15N2OS/c1-2-7-14-11-5-3-4-6-12(11)15-8-10(16)9-17-13(14)15/h2-6,10,16H,1,7-9H2/q+1/t10-/m1/s1 |
| InChIKey | NPVODFWFYYFCPH-SNVBAGLBSA-N |
| XLogP | 1.58 |
| TPSA | 29.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.34 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|