About sulfanylmethylurea
sulfanylmethylurea (PubChem CID 87262805) has the molecular formula C2H6N2OS
and a molecular weight of 106.15 g/mol. Its IUPAC name is sulfanylmethylurea.
Molecular Properties
| Compound Name | sulfanylmethylurea |
| PubChem CID | 87262805 |
| Molecular Formula | C2H6N2OS |
| Molecular Weight | 106.15 g/mol |
| Exact Mass | 106.02 |
| IUPAC Name | sulfanylmethylurea |
| SMILES | NC(=O)NCS |
| InChI | InChI=1S/C2H6N2OS/c3-2(5)4-1-6/h6H,1H2,(H3,3,4,5) |
| InChIKey | ZOMWAJBTHZXANJ-UHFFFAOYSA-N |
| XLogP | -0.46 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 106.15 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze sulfanylmethylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sulfanylmethylurea?
The IUPAC name of sulfanylmethylurea (CID 87262805) is sulfanylmethylurea.
What is the SMILES notation for sulfanylmethylurea?
The canonical SMILES for sulfanylmethylurea is NC(=O)NCS.
What is the InChIKey of sulfanylmethylurea?
The InChIKey is ZOMWAJBTHZXANJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H6N2OS/c3-2(5)4-1-6/h6H,1H2,(H3,3,4,5).
What are the key properties of sulfanylmethylurea?
sulfanylmethylurea has a molecular weight of 106.15 g/mol, XLogP of -0.46, 1 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for sulfanylmethylurea is sourced from PubChem (CID 87262805), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).