About 3-(3-ethylimidazol-1-ium-1-yl)propane-1,2-diol;bis(trifluoromethanesulfonamide)
3-(3-ethylimidazol-1-ium-1-yl)propane-1,2-diol;bis(trifluoromethanesulfonamide) (PubChem CID 87262808) has the molecular formula C10H19F6N4O6S2+
and a molecular weight of 469.41 g/mol. Its IUPAC name is 3-(3-ethylimidazol-1-ium-1-yl)propane-1,2-diol;bis(trifluoromethanesulfonamide).
Molecular Properties
| Compound Name | 3-(3-ethylimidazol-1-ium-1-yl)propane-1,2-diol;bis(trifluoromethanesulfonamide) |
| PubChem CID | 87262808 |
| Molecular Formula | C10H19F6N4O6S2+ |
| Molecular Weight | 469.41 g/mol |
| Exact Mass | 469.06 |
| IUPAC Name | 3-(3-ethylimidazol-1-ium-1-yl)propane-1,2-diol;bis(trifluoromethanesulfonamide) |
| SMILES | CCn1cc[n+](CC(O)CO)c1.NS(=O)(=O)C(F)(F)F.NS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C8H15N2O2.2CH2F3NO2S/c1-2-9-3-4-10(7-9)5-8(12)6-11;2*2-1(3,4)8(5,6)7/h3-4,7-8,11-12H,2,5-6H2,1H3;2*(H2,5,6,7)/q+1;; |
| InChIKey | OPNLESMIZWRDBV-UHFFFAOYSA-N |
| XLogP | -1.26 |
| TPSA | 169.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 469.41 |
| LogP ≤ 5 | -1.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 3-(3-ethylimidazol-1-ium-1-yl)propane-1,2-diol;bis(trifluoromethanesulfonamide) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3-ethylimidazol-1-ium-1-yl)propane-1,2-diol;bis(trifluoromethanesulfonamide)?
The IUPAC name of 3-(3-ethylimidazol-1-ium-1-yl)propane-1,2-diol;bis(trifluoromethanesulfonamide) (CID 87262808) is 3-(3-ethylimidazol-1-ium-1-yl)propane-1,2-diol;bis(trifluoromethanesulfonamide).
What is the SMILES notation for 3-(3-ethylimidazol-1-ium-1-yl)propane-1,2-diol;bis(trifluoromethanesulfonamide)?
The canonical SMILES for 3-(3-ethylimidazol-1-ium-1-yl)propane-1,2-diol;bis(trifluoromethanesulfonamide) is CCn1cc[n+](CC(O)CO)c1.NS(=O)(=O)C(F)(F)F.NS(=O)(=O)C(F)(F)F.
What is the InChIKey of 3-(3-ethylimidazol-1-ium-1-yl)propane-1,2-diol;bis(trifluoromethanesulfonamide)?
The InChIKey is OPNLESMIZWRDBV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15N2O2.2CH2F3NO2S/c1-2-9-3-4-10(7-9)5-8(12)6-11;2*2-1(3,4)8(5,6)7/h3-4,7-8,11-12H,2,5-6H2,1H3;2*(H2,5,6,7)/q+1;;.
What are the key properties of 3-(3-ethylimidazol-1-ium-1-yl)propane-1,2-diol;bis(trifluoromethanesulfonamide)?
3-(3-ethylimidazol-1-ium-1-yl)propane-1,2-diol;bis(trifluoromethanesulfonamide) has a molecular weight of 469.41 g/mol, XLogP of -1.26, 4 rotatable bonds, 4 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-ethylimidazol-1-ium-1-yl)propane-1,2-diol;bis(trifluoromethanesulfonamide) is sourced from PubChem (CID 87262808), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).