About 4-(iminomethylideneamino)-1-N,1-N-dimethylpentane-1,3-diamine
4-(iminomethylideneamino)-1-N,1-N-dimethylpentane-1,3-diamine (PubChem CID 87263250) has the molecular formula C8H18N4
and a molecular weight of 170.26 g/mol. Its IUPAC name is 4-(iminomethylideneamino)-1-N,1-N-dimethylpentane-1,3-diamine.
Molecular Properties
| Compound Name | 4-(iminomethylideneamino)-1-N,1-N-dimethylpentane-1,3-diamine |
| PubChem CID | 87263250 |
| Molecular Formula | C8H18N4 |
| Molecular Weight | 170.26 g/mol |
| Exact Mass | 170.15 |
| IUPAC Name | 4-(iminomethylideneamino)-1-N,1-N-dimethylpentane-1,3-diamine |
| SMILES | CC(N=C=N)C(N)CCN(C)C |
| InChI | InChI=1S/C8H18N4/c1-7(11-6-9)8(10)4-5-12(2)3/h7-9H,4-5,10H2,1-3H3 |
| InChIKey | BQRAPYYYYFSKQF-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 65.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.26 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 4-(iminomethylideneamino)-1-N,1-N-dimethylpentane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(iminomethylideneamino)-1-N,1-N-dimethylpentane-1,3-diamine?
The IUPAC name of 4-(iminomethylideneamino)-1-N,1-N-dimethylpentane-1,3-diamine (CID 87263250) is 4-(iminomethylideneamino)-1-N,1-N-dimethylpentane-1,3-diamine.
What is the SMILES notation for 4-(iminomethylideneamino)-1-N,1-N-dimethylpentane-1,3-diamine?
The canonical SMILES for 4-(iminomethylideneamino)-1-N,1-N-dimethylpentane-1,3-diamine is CC(N=C=N)C(N)CCN(C)C.
What is the InChIKey of 4-(iminomethylideneamino)-1-N,1-N-dimethylpentane-1,3-diamine?
The InChIKey is BQRAPYYYYFSKQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18N4/c1-7(11-6-9)8(10)4-5-12(2)3/h7-9H,4-5,10H2,1-3H3.
What are the key properties of 4-(iminomethylideneamino)-1-N,1-N-dimethylpentane-1,3-diamine?
4-(iminomethylideneamino)-1-N,1-N-dimethylpentane-1,3-diamine has a molecular weight of 170.26 g/mol, XLogP of 0.41, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(iminomethylideneamino)-1-N,1-N-dimethylpentane-1,3-diamine is sourced from PubChem (CID 87263250), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).