About N-(3,5-diformamidophenyl)formamide
N-(3,5-diformamidophenyl)formamide (PubChem CID 87263269) has the molecular formula C9H9N3O3
and a molecular weight of 207.19 g/mol. Its IUPAC name is N-(3,5-diformamidophenyl)formamide.
Molecular Properties
| Compound Name | N-(3,5-diformamidophenyl)formamide |
| PubChem CID | 87263269 |
| Molecular Formula | C9H9N3O3 |
| Molecular Weight | 207.19 g/mol |
| Exact Mass | 207.06 |
| IUPAC Name | N-(3,5-diformamidophenyl)formamide |
| SMILES | O=CNc1cc(NC=O)cc(NC=O)c1 |
| InChI | InChI=1S/C9H9N3O3/c13-4-10-7-1-8(11-5-14)3-9(2-7)12-6-15/h1-6H,(H,10,13)(H,11,14)(H,12,15) |
| InChIKey | KMQIMDNQSNRDBJ-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.19 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze N-(3,5-diformamidophenyl)formamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3,5-diformamidophenyl)formamide?
The IUPAC name of N-(3,5-diformamidophenyl)formamide (CID 87263269) is N-(3,5-diformamidophenyl)formamide.
What is the SMILES notation for N-(3,5-diformamidophenyl)formamide?
The canonical SMILES for N-(3,5-diformamidophenyl)formamide is O=CNc1cc(NC=O)cc(NC=O)c1.
What is the InChIKey of N-(3,5-diformamidophenyl)formamide?
The InChIKey is KMQIMDNQSNRDBJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9N3O3/c13-4-10-7-1-8(11-5-14)3-9(2-7)12-6-15/h1-6H,(H,10,13)(H,11,14)(H,12,15).
What are the key properties of N-(3,5-diformamidophenyl)formamide?
N-(3,5-diformamidophenyl)formamide has a molecular weight of 207.19 g/mol, XLogP of 0.39, 6 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3,5-diformamidophenyl)formamide is sourced from PubChem (CID 87263269), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).