About (4-oxo-1-adamantyl) 2,2-difluoro-2-(triphenyl-λ4-sulfanyl)oxysulfonylacetate
(4-oxo-1-adamantyl) 2,2-difluoro-2-(triphenyl-λ4-sulfanyl)oxysulfonylacetate (PubChem CID 87263664) has the molecular formula C30H28F2O6S2
and a molecular weight of 586.68 g/mol. Its IUPAC name is (4-oxo-1-adamantyl) 2,2-difluoro-2-(triphenyl-λ4-sulfanyl)oxysulfonylacetate.
Molecular Properties
| Compound Name | (4-oxo-1-adamantyl) 2,2-difluoro-2-(triphenyl-λ4-sulfanyl)oxysulfonylacetate |
| PubChem CID | 87263664 |
| Molecular Formula | C30H28F2O6S2 |
| Molecular Weight | 586.68 g/mol |
| Exact Mass | 586.13 |
| IUPAC Name | (4-oxo-1-adamantyl) 2,2-difluoro-2-(triphenyl-λ4-sulfanyl)oxysulfonylacetate |
| SMILES | O=C1C2CC3CC1CC(OC(=O)C(F)(F)S(=O)(=O)OS(c1ccccc1)(c1ccccc1)c1ccccc1)(C3)C2 |
| InChI | InChI=1S/C30H28F2O6S2/c31-30(32,28(34)37-29-18-21-16-22(19-29)27(33)23(17-21)20-29)40(35,36)38-39(24-10-4-1-5-11-24,25-12-6-2-7-13-25)26-14-8-3-9-15-26/h1-15,21-23H,16-20H2 |
| InChIKey | XWPKDTUZECEIFX-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 586.68 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (4-oxo-1-adamantyl) 2,2-difluoro-2-(triphenyl-λ4-sulfanyl)oxysulfonylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-oxo-1-adamantyl) 2,2-difluoro-2-(triphenyl-λ4-sulfanyl)oxysulfonylacetate?
The IUPAC name of (4-oxo-1-adamantyl) 2,2-difluoro-2-(triphenyl-λ4-sulfanyl)oxysulfonylacetate (CID 87263664) is (4-oxo-1-adamantyl) 2,2-difluoro-2-(triphenyl-λ4-sulfanyl)oxysulfonylacetate.
What is the SMILES notation for (4-oxo-1-adamantyl) 2,2-difluoro-2-(triphenyl-λ4-sulfanyl)oxysulfonylacetate?
The canonical SMILES for (4-oxo-1-adamantyl) 2,2-difluoro-2-(triphenyl-λ4-sulfanyl)oxysulfonylacetate is O=C1C2CC3CC1CC(OC(=O)C(F)(F)S(=O)(=O)OS(c1ccccc1)(c1ccccc1)c1ccccc1)(C3)C2.
What is the InChIKey of (4-oxo-1-adamantyl) 2,2-difluoro-2-(triphenyl-λ4-sulfanyl)oxysulfonylacetate?
The InChIKey is XWPKDTUZECEIFX-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H28F2O6S2/c31-30(32,28(34)37-29-18-21-16-22(19-29)27(33)23(17-21)20-29)40(35,36)38-39(24-10-4-1-5-11-24,25-12-6-2-7-13-25)26-14-8-3-9-15-26/h1-15,21-23H,16-20H2.
What are the key properties of (4-oxo-1-adamantyl) 2,2-difluoro-2-(triphenyl-λ4-sulfanyl)oxysulfonylacetate?
(4-oxo-1-adamantyl) 2,2-difluoro-2-(triphenyl-λ4-sulfanyl)oxysulfonylacetate has a molecular weight of 586.68 g/mol, XLogP of 6.51, 8 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (4-oxo-1-adamantyl) 2,2-difluoro-2-(triphenyl-λ4-sulfanyl)oxysulfonylacetate is sourced from PubChem (CID 87263664), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).