C19H31N7O4 — CID 87263788
N-[(2R)-2-[[(4-cyclopropyl-6-morpholin-4-yl-1,3,5-triazin-2-yl)amino]carbamoyl]heptyl]-N-hydroxyformamide (PubChem CID 87263788) has the molecular formula C19H31N7O4 and a molecular weight of 421.50 g/mol. Its IUPAC name is N-[(2R)-2-[[(4-cyclopropyl-6-morpholin-4-yl-1,3,5-triazin-2-yl)amino]carbamoyl]heptyl]-N-hydroxyformamide.
| Compound Name | N-[(2R)-2-[[(4-cyclopropyl-6-morpholin-4-yl-1,3,5-triazin-2-yl)amino]carbamoyl]heptyl]-N-hydroxyformamide |
|---|---|
| PubChem CID | 87263788 |
| Molecular Formula | C19H31N7O4 |
| Molecular Weight | 421.50 g/mol |
| Exact Mass | 421.24 |
| IUPAC Name | N-[(2R)-2-[[(4-cyclopropyl-6-morpholin-4-yl-1,3,5-triazin-2-yl)amino]carbamoyl]heptyl]-N-hydroxyformamide |
| SMILES | CCCCC[C@H](CN(O)C=O)C(=O)NNc1nc(C2CC2)nc(N2CCOCC2)n1 |
| InChI | InChI=1S/C19H31N7O4/c1-2-3-4-5-15(12-26(29)13-27)17(28)23-24-18-20-16(14-6-7-14)21-19(22-18)25-8-10-30-11-9-25/h13-15,29H,2-12H2,1H3,(H,23,28)(H,20,21,22,24)/t15-/m1/s1 |
| InChIKey | MKUTYSDFJKJVFV-OAHLLOKOSA-N |
| XLogP | 1.07 |
| TPSA | 132.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.50 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|