C17H31N7O4 — CID 87263795
N-hydroxy-N-[(2R)-2-[[[4-[[2-methoxyethyl(methyl)amino]methyl]-1,3,5-triazin-2-yl]amino]carbamoyl]heptyl]formamide (PubChem CID 87263795) has the molecular formula C17H31N7O4 and a molecular weight of 397.48 g/mol. Its IUPAC name is N-hydroxy-N-[(2R)-2-[[[4-[[2-methoxyethyl(methyl)amino]methyl]-1,3,5-triazin-2-yl]amino]carbamoyl]heptyl]formamide.
| Compound Name | N-hydroxy-N-[(2R)-2-[[[4-[[2-methoxyethyl(methyl)amino]methyl]-1,3,5-triazin-2-yl]amino]carbamoyl]heptyl]formamide |
|---|---|
| PubChem CID | 87263795 |
| Molecular Formula | C17H31N7O4 |
| Molecular Weight | 397.48 g/mol |
| Exact Mass | 397.24 |
| IUPAC Name | N-hydroxy-N-[(2R)-2-[[[4-[[2-methoxyethyl(methyl)amino]methyl]-1,3,5-triazin-2-yl]amino]carbamoyl]heptyl]formamide |
| SMILES | CCCCC[C@H](CN(O)C=O)C(=O)NNc1ncnc(CN(C)CCOC)n1 |
| InChI | InChI=1S/C17H31N7O4/c1-4-5-6-7-14(10-24(27)13-25)16(26)21-22-17-19-12-18-15(20-17)11-23(2)8-9-28-3/h12-14,27H,4-11H2,1-3H3,(H,21,26)(H,18,19,20,22)/t14-/m1/s1 |
| InChIKey | GINLNXKVKZEOAR-CQSZACIVSA-N |
| XLogP | 0.44 |
| TPSA | 132.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.48 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|