C17H24N6O3 — CID 87263862
N-[4,4-dimethyl-2-[[(7-methyl-1,2,4-benzotriazin-3-yl)amino]carbamoyl]pentyl]-N-hydroxyformamide (PubChem CID 87263862) has the molecular formula C17H24N6O3 and a molecular weight of 360.42 g/mol. Its IUPAC name is N-[4,4-dimethyl-2-[[(7-methyl-1,2,4-benzotriazin-3-yl)amino]carbamoyl]pentyl]-N-hydroxyformamide.
| Compound Name | N-[4,4-dimethyl-2-[[(7-methyl-1,2,4-benzotriazin-3-yl)amino]carbamoyl]pentyl]-N-hydroxyformamide |
|---|---|
| PubChem CID | 87263862 |
| Molecular Formula | C17H24N6O3 |
| Molecular Weight | 360.42 g/mol |
| Exact Mass | 360.19 |
| IUPAC Name | N-[4,4-dimethyl-2-[[(7-methyl-1,2,4-benzotriazin-3-yl)amino]carbamoyl]pentyl]-N-hydroxyformamide |
| SMILES | Cc1ccc2nc(NNC(=O)C(CN(O)C=O)CC(C)(C)C)nnc2c1 |
| InChI | InChI=1S/C17H24N6O3/c1-11-5-6-13-14(7-11)19-21-16(18-13)22-20-15(25)12(8-17(2,3)4)9-23(26)10-24/h5-7,10,12,26H,8-9H2,1-4H3,(H,20,25)(H,18,21,22) |
| InChIKey | JPJBPOWHKSNJAL-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 120.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.42 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|