C21H38N8O3 — CID 87263884
N-[(2R)-2-[[[4-(4-ethylpiperazin-1-yl)-6-propan-2-yl-1,3,5-triazin-2-yl]amino]carbamoyl]heptyl]-N-hydroxyformamide (PubChem CID 87263884) has the molecular formula C21H38N8O3 and a molecular weight of 450.59 g/mol. Its IUPAC name is N-[(2R)-2-[[[4-(4-ethylpiperazin-1-yl)-6-propan-2-yl-1,3,5-triazin-2-yl]amino]carbamoyl]heptyl]-N-hydroxyformamide.
| Compound Name | N-[(2R)-2-[[[4-(4-ethylpiperazin-1-yl)-6-propan-2-yl-1,3,5-triazin-2-yl]amino]carbamoyl]heptyl]-N-hydroxyformamide |
|---|---|
| PubChem CID | 87263884 |
| Molecular Formula | C21H38N8O3 |
| Molecular Weight | 450.59 g/mol |
| Exact Mass | 450.31 |
| IUPAC Name | N-[(2R)-2-[[[4-(4-ethylpiperazin-1-yl)-6-propan-2-yl-1,3,5-triazin-2-yl]amino]carbamoyl]heptyl]-N-hydroxyformamide |
| SMILES | CCCCC[C@H](CN(O)C=O)C(=O)NNc1nc(C(C)C)nc(N2CCN(CC)CC2)n1 |
| InChI | InChI=1S/C21H38N8O3/c1-5-7-8-9-17(14-29(32)15-30)19(31)25-26-20-22-18(16(3)4)23-21(24-20)28-12-10-27(6-2)11-13-28/h15-17,32H,5-14H2,1-4H3,(H,25,31)(H,22,23,24,26)/t17-/m1/s1 |
| InChIKey | PNMPSVNXOWFUBZ-QGZVFWFLSA-N |
| XLogP | 1.62 |
| TPSA | 126.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.59 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|