C14H21FN4O3 — CID 87264014
N-[(2S)-2-[[(6-fluoro-2-pyridinyl)amino]carbamoyl]heptyl]-N-hydroxyformamide (PubChem CID 87264014) has the molecular formula C14H21FN4O3 and a molecular weight of 312.35 g/mol. Its IUPAC name is N-[(2S)-2-[[(6-fluoro-2-pyridinyl)amino]carbamoyl]heptyl]-N-hydroxyformamide.
| Compound Name | N-[(2S)-2-[[(6-fluoro-2-pyridinyl)amino]carbamoyl]heptyl]-N-hydroxyformamide |
|---|---|
| PubChem CID | 87264014 |
| Molecular Formula | C14H21FN4O3 |
| Molecular Weight | 312.35 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | N-[(2S)-2-[[(6-fluoro-2-pyridinyl)amino]carbamoyl]heptyl]-N-hydroxyformamide |
| SMILES | CCCCC[C@@H](CN(O)C=O)C(=O)NNc1cccc(F)n1 |
| InChI | InChI=1S/C14H21FN4O3/c1-2-3-4-6-11(9-19(22)10-20)14(21)18-17-13-8-5-7-12(15)16-13/h5,7-8,10-11,22H,2-4,6,9H2,1H3,(H,16,17)(H,18,21)/t11-/m0/s1 |
| InChIKey | TZSXUUIYXPZTIN-NSHDSACASA-N |
| XLogP | 1.71 |
| TPSA | 94.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.35 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|