C17H23FN6O3 — CID 87264152
N-[(2S)-2-[[(7-fluoro-1,2,4-benzotriazin-3-yl)amino]carbamoyl]-6-methylheptyl]-N-hydroxyformamide (PubChem CID 87264152) has the molecular formula C17H23FN6O3 and a molecular weight of 378.41 g/mol. Its IUPAC name is N-[(2S)-2-[[(7-fluoro-1,2,4-benzotriazin-3-yl)amino]carbamoyl]-6-methylheptyl]-N-hydroxyformamide.
| Compound Name | N-[(2S)-2-[[(7-fluoro-1,2,4-benzotriazin-3-yl)amino]carbamoyl]-6-methylheptyl]-N-hydroxyformamide |
|---|---|
| PubChem CID | 87264152 |
| Molecular Formula | C17H23FN6O3 |
| Molecular Weight | 378.41 g/mol |
| Exact Mass | 378.18 |
| IUPAC Name | N-[(2S)-2-[[(7-fluoro-1,2,4-benzotriazin-3-yl)amino]carbamoyl]-6-methylheptyl]-N-hydroxyformamide |
| SMILES | CC(C)CCC[C@@H](CN(O)C=O)C(=O)NNc1nnc2cc(F)ccc2n1 |
| InChI | InChI=1S/C17H23FN6O3/c1-11(2)4-3-5-12(9-24(27)10-25)16(26)21-23-17-19-14-7-6-13(18)8-15(14)20-22-17/h6-8,10-12,27H,3-5,9H2,1-2H3,(H,21,26)(H,19,22,23)/t12-/m0/s1 |
| InChIKey | YYEZNNBRJRJESP-LBPRGKRZSA-N |
| XLogP | 1.90 |
| TPSA | 120.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.41 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|