C29H39N3O7 — CID 87264337
tert-butyl N-(1,3-benzodioxol-4-yl)-N-[2-[[formyl(phenylmethoxy)amino]methyl]heptanoyl-methylamino]carbamate (PubChem CID 87264337) has the molecular formula C29H39N3O7 and a molecular weight of 541.65 g/mol. Its IUPAC name is tert-butyl N-(1,3-benzodioxol-4-yl)-N-[2-[[formyl(phenylmethoxy)amino]methyl]heptanoyl-methylamino]carbamate.
| Compound Name | tert-butyl N-(1,3-benzodioxol-4-yl)-N-[2-[[formyl(phenylmethoxy)amino]methyl]heptanoyl-methylamino]carbamate |
|---|---|
| PubChem CID | 87264337 |
| Molecular Formula | C29H39N3O7 |
| Molecular Weight | 541.65 g/mol |
| Exact Mass | 541.28 |
| IUPAC Name | tert-butyl N-(1,3-benzodioxol-4-yl)-N-[2-[[formyl(phenylmethoxy)amino]methyl]heptanoyl-methylamino]carbamate |
| SMILES | CCCCCC(CN(C=O)OCc1ccccc1)C(=O)N(C)N(C(=O)OC(C)(C)C)c1cccc2c1OCO2 |
| InChI | InChI=1S/C29H39N3O7/c1-6-7-9-15-23(18-31(20-33)38-19-22-13-10-8-11-14-22)27(34)30(5)32(28(35)39-29(2,3)4)24-16-12-17-25-26(24)37-21-36-25/h8,10-14,16-17,20,23H,6-7,9,15,18-19,21H2,1-5H3 |
| InChIKey | IXXYGCMLHUVVQP-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 97.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.65 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|