C30H25F9N6O2S — CID 87264859
[1-[[5-(3-methyl-2H-indazol-5-yl)-1,3,4-thiadiazol-2-yl]amino]-3-[3-(trifluoromethyl)phenyl]propan-2-yl]-[[3-(trifluoromethyl)phenyl]methyl]azanium;2,2,2-trifluoroacetate (PubChem CID 87264859) has the molecular formula C30H25F9N6O2S and a molecular weight of 704.62 g/mol. Its IUPAC name is [1-[[5-(3-methyl-2H-indazol-5-yl)-1,3,4-thiadiazol-2-yl]amino]-3-[3-(trifluoromethyl)phenyl]propan-2-yl]-[[3-(trifluoromethyl)phenyl]methyl]azanium;2,2,2-trifluoroacetate.
| Compound Name | [1-[[5-(3-methyl-2H-indazol-5-yl)-1,3,4-thiadiazol-2-yl]amino]-3-[3-(trifluoromethyl)phenyl]propan-2-yl]-[[3-(trifluoromethyl)phenyl]methyl]azanium;2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 87264859 |
| Molecular Formula | C30H25F9N6O2S |
| Molecular Weight | 704.62 g/mol |
| Exact Mass | 704.16 |
| IUPAC Name | [1-[[5-(3-methyl-2H-indazol-5-yl)-1,3,4-thiadiazol-2-yl]amino]-3-[3-(trifluoromethyl)phenyl]propan-2-yl]-[[3-(trifluoromethyl)phenyl]methyl]azanium;2,2,2-trifluoroacetate |
| SMILES | Cc1[nH]nc2ccc(-c3nnc(NCC(Cc4cccc(C(F)(F)F)c4)[NH2+]Cc4cccc(C(F)(F)F)c4)s3)cc12.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C28H24F6N6S.C2HF3O2/c1-16-23-13-19(8-9-24(23)38-37-16)25-39-40-26(41-25)36-15-22(12-17-4-2-6-20(10-17)27(29,30)31)35-14-18-5-3-7-21(11-18)28(32,33)34;3-2(4,5)1(6)7/h2-11,13,22,35H,12,14-15H2,1H3,(H,36,40)(H,37,38);(H,6,7) |
| InChIKey | UTUCZXVPKVSEGZ-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 123.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.62 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |