C60H56N8O8Pt — CID 87265246
bis(3-[18-(2-carboxylatoethyl)-3,8,13,17-tetramethyl-22,23-dihydroporphyrin-2-yl]propanoate);platinum(4+) (PubChem CID 87265246) has the molecular formula C60H56N8O8Pt and a molecular weight of 1212.23 g/mol. Its IUPAC name is bis(3-[18-(2-carboxylatoethyl)-3,8,13,17-tetramethyl-22,23-dihydroporphyrin-2-yl]propanoate);platinum(4+).
| Compound Name | bis(3-[18-(2-carboxylatoethyl)-3,8,13,17-tetramethyl-22,23-dihydroporphyrin-2-yl]propanoate);platinum(4+) |
|---|---|
| PubChem CID | 87265246 |
| Molecular Formula | C60H56N8O8Pt |
| Molecular Weight | 1212.23 g/mol |
| Exact Mass | 1211.39 |
| IUPAC Name | bis(3-[18-(2-carboxylatoethyl)-3,8,13,17-tetramethyl-22,23-dihydroporphyrin-2-yl]propanoate);platinum(4+) |
| SMILES | CC1=C(CCC(=O)[O-])c2cc3nc(cc4[nH]c(cc4C)cc4[nH]c(cc1n2)cc4C)C(C)=C3CCC(=O)[O-].CC1=C(CCC(=O)[O-])c2cc3nc(cc4[nH]c(cc4C)cc4[nH]c(cc1n2)cc4C)C(C)=C3CCC(=O)[O-].[Pt+4] |
| InChI | InChI=1S/2C30H30N4O4.Pt/c2*1-15-9-20-12-25-17(3)21(5-7-29(35)36)27(33-25)14-28-22(6-8-30(37)38)18(4)26(34-28)13-24-16(2)10-19(32-24)11-23(15)31-20;/h2*9-14,31-32H,5-8H2,1-4H3,(H,35,36)(H,37,38);/q;;+4/p-4/b2*19-11-,20-12-,23-11-,24-13-,25-12-,26-13-,27-14-,28-14-; |
| InChIKey | PFOMMXXJMSFGCJ-SFPNKPENSA-J |
| XLogP | 7.70 |
| TPSA | 275.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 77 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1212.23 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |