C13H13F6NO2 — CID 872658
N-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2,6-dimethylphenyl]acetamide (PubChem CID 872658) has the molecular formula C13H13F6NO2 and a molecular weight of 329.24 g/mol. Its IUPAC name is N-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2,6-dimethylphenyl]acetamide.
| Compound Name | N-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2,6-dimethylphenyl]acetamide |
|---|---|
| PubChem CID | 872658 |
| Molecular Formula | C13H13F6NO2 |
| Molecular Weight | 329.24 g/mol |
| Exact Mass | 329.09 |
| IUPAC Name | N-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2,6-dimethylphenyl]acetamide |
| SMILES | CC(=O)Nc1c(C)cc(C(O)(C(F)(F)F)C(F)(F)F)cc1C |
| InChI | InChI=1S/C13H13F6NO2/c1-6-4-9(5-7(2)10(6)20-8(3)21)11(22,12(14,15)16)13(17,18)19/h4-5,22H,1-3H3,(H,20,21) |
| InChIKey | APDWVBKPQBQCPP-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.24 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |