About [ethenyl(diphenyl)-λ4-sulfanyl] trifluoromethanesulfonate
[ethenyl(diphenyl)-λ4-sulfanyl] trifluoromethanesulfonate (PubChem CID 87266301) has the molecular formula C15H13F3O3S2
and a molecular weight of 362.39 g/mol. Its IUPAC name is [ethenyl(diphenyl)-λ4-sulfanyl] trifluoromethanesulfonate.
Molecular Properties
| Compound Name | [ethenyl(diphenyl)-λ4-sulfanyl] trifluoromethanesulfonate |
| PubChem CID | 87266301 |
| Molecular Formula | C15H13F3O3S2 |
| Molecular Weight | 362.39 g/mol |
| Exact Mass | 362.03 |
| IUPAC Name | [ethenyl(diphenyl)-λ4-sulfanyl] trifluoromethanesulfonate |
| SMILES | C=CS(OS(=O)(=O)C(F)(F)F)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C15H13F3O3S2/c1-2-22(13-9-5-3-6-10-13,14-11-7-4-8-12-14)21-23(19,20)15(16,17)18/h2-12H,1H2 |
| InChIKey | MDNHBGAAYRZJKN-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.39 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze [ethenyl(diphenyl)-λ4-sulfanyl] trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [ethenyl(diphenyl)-λ4-sulfanyl] trifluoromethanesulfonate?
The IUPAC name of [ethenyl(diphenyl)-λ4-sulfanyl] trifluoromethanesulfonate (CID 87266301) is [ethenyl(diphenyl)-λ4-sulfanyl] trifluoromethanesulfonate.
What is the SMILES notation for [ethenyl(diphenyl)-λ4-sulfanyl] trifluoromethanesulfonate?
The canonical SMILES for [ethenyl(diphenyl)-λ4-sulfanyl] trifluoromethanesulfonate is C=CS(OS(=O)(=O)C(F)(F)F)(c1ccccc1)c1ccccc1.
What is the InChIKey of [ethenyl(diphenyl)-λ4-sulfanyl] trifluoromethanesulfonate?
The InChIKey is MDNHBGAAYRZJKN-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13F3O3S2/c1-2-22(13-9-5-3-6-10-13,14-11-7-4-8-12-14)21-23(19,20)15(16,17)18/h2-12H,1H2.
What are the key properties of [ethenyl(diphenyl)-λ4-sulfanyl] trifluoromethanesulfonate?
[ethenyl(diphenyl)-λ4-sulfanyl] trifluoromethanesulfonate has a molecular weight of 362.39 g/mol, XLogP of 4.83, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [ethenyl(diphenyl)-λ4-sulfanyl] trifluoromethanesulfonate is sourced from PubChem (CID 87266301), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).