About 2-ethylselanyl-7H-purine
2-ethylselanyl-7H-purine (PubChem CID 87266635) has the molecular formula C7H8N4Se
and a molecular weight of 227.13 g/mol. Its IUPAC name is 2-ethylselanyl-7H-purine.
Molecular Properties
| Compound Name | 2-ethylselanyl-7H-purine |
| PubChem CID | 87266635 |
| Molecular Formula | C7H8N4Se |
| Molecular Weight | 227.13 g/mol |
| Exact Mass | 227.99 |
| IUPAC Name | 2-ethylselanyl-7H-purine |
| SMILES | CC[Se]c1ncc2[nH]cnc2n1 |
| InChI | InChI=1S/C7H8N4Se/c1-2-12-7-8-3-5-6(11-7)10-4-9-5/h3-4H,2H2,1H3,(H,8,9,10,11) |
| InChIKey | UPHFLQSUAWVPDJ-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.13 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-ethylselanyl-7H-purine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethylselanyl-7H-purine?
The IUPAC name of 2-ethylselanyl-7H-purine (CID 87266635) is 2-ethylselanyl-7H-purine.
What is the SMILES notation for 2-ethylselanyl-7H-purine?
The canonical SMILES for 2-ethylselanyl-7H-purine is CC[Se]c1ncc2[nH]cnc2n1.
What is the InChIKey of 2-ethylselanyl-7H-purine?
The InChIKey is UPHFLQSUAWVPDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N4Se/c1-2-12-7-8-3-5-6(11-7)10-4-9-5/h3-4H,2H2,1H3,(H,8,9,10,11).
What are the key properties of 2-ethylselanyl-7H-purine?
2-ethylselanyl-7H-purine has a molecular weight of 227.13 g/mol, XLogP of 0.12, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethylselanyl-7H-purine is sourced from PubChem (CID 87266635), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).