C15H24O3Si — CID 87267186
[(4S,5R)-2,2-dimethyl-5-[(1E,3E)-6-trimethylsilylhexa-1,3-dien-5-ynyl]-1,3-dioxolan-4-yl]methanol (PubChem CID 87267186) has the molecular formula C15H24O3Si and a molecular weight of 280.44 g/mol. Its IUPAC name is [(4S,5R)-2,2-dimethyl-5-[(1E,3E)-6-trimethylsilylhexa-1,3-dien-5-ynyl]-1,3-dioxolan-4-yl]methanol.
| Compound Name | [(4S,5R)-2,2-dimethyl-5-[(1E,3E)-6-trimethylsilylhexa-1,3-dien-5-ynyl]-1,3-dioxolan-4-yl]methanol |
|---|---|
| PubChem CID | 87267186 |
| Molecular Formula | C15H24O3Si |
| Molecular Weight | 280.44 g/mol |
| Exact Mass | 280.15 |
| IUPAC Name | [(4S,5R)-2,2-dimethyl-5-[(1E,3E)-6-trimethylsilylhexa-1,3-dien-5-ynyl]-1,3-dioxolan-4-yl]methanol |
| SMILES | CC1(C)O[C@@H](CO)[C@@H](/C=C/C=C/C#C[Si](C)(C)C)O1 |
| InChI | InChI=1S/C15H24O3Si/c1-15(2)17-13(14(12-16)18-15)10-8-6-7-9-11-19(3,4)5/h6-8,10,13-14,16H,12H2,1-5H3/b7-6+,10-8+/t13-,14+/m1/s1 |
| InChIKey | LCHGULXUBILIGF-FOASLXJTSA-N |
| XLogP | 2.49 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.44 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|