C15H20O5 — CID 87267240
2-[2-[(4S,5R)-5-[(1E,3E)-hexa-1,3-dien-5-ynyl]-2,2-dimethyl-1,3-dioxolan-4-yl]ethoxy]acetic acid (PubChem CID 87267240) has the molecular formula C15H20O5 and a molecular weight of 280.32 g/mol. Its IUPAC name is 2-[2-[(4S,5R)-5-[(1E,3E)-hexa-1,3-dien-5-ynyl]-2,2-dimethyl-1,3-dioxolan-4-yl]ethoxy]acetic acid.
| Compound Name | 2-[2-[(4S,5R)-5-[(1E,3E)-hexa-1,3-dien-5-ynyl]-2,2-dimethyl-1,3-dioxolan-4-yl]ethoxy]acetic acid |
|---|---|
| PubChem CID | 87267240 |
| Molecular Formula | C15H20O5 |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.13 |
| IUPAC Name | 2-[2-[(4S,5R)-5-[(1E,3E)-hexa-1,3-dien-5-ynyl]-2,2-dimethyl-1,3-dioxolan-4-yl]ethoxy]acetic acid |
| SMILES | C#C/C=C/C=C/[C@H]1OC(C)(C)O[C@H]1CCOCC(=O)O |
| InChI | InChI=1S/C15H20O5/c1-4-5-6-7-8-12-13(20-15(2,3)19-12)9-10-18-11-14(16)17/h1,5-8,12-13H,9-11H2,2-3H3,(H,16,17)/b6-5+,8-7+/t12-,13+/m1/s1 |
| InChIKey | KKRDCCAVJKBTSC-IOJRMFQUSA-N |
| XLogP | 1.74 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|