C9H14O6 — CID 87267459
2-[[(4S,5S)-5-formyl-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]acetic acid (PubChem CID 87267459) has the molecular formula C9H14O6 and a molecular weight of 218.20 g/mol. Its IUPAC name is 2-[[(4S,5S)-5-formyl-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]acetic acid.
| Compound Name | 2-[[(4S,5S)-5-formyl-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]acetic acid |
|---|---|
| PubChem CID | 87267459 |
| Molecular Formula | C9H14O6 |
| Molecular Weight | 218.20 g/mol |
| Exact Mass | 218.08 |
| IUPAC Name | 2-[[(4S,5S)-5-formyl-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]acetic acid |
| SMILES | CC1(C)O[C@@H](COCC(=O)O)[C@@H](C=O)O1 |
| InChI | InChI=1S/C9H14O6/c1-9(2)14-6(3-10)7(15-9)4-13-5-8(11)12/h3,6-7H,4-5H2,1-2H3,(H,11,12)/t6-,7+/m1/s1 |
| InChIKey | MQHCFJYUIVAFCO-RQJHMYQMSA-N |
| XLogP | -0.19 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.20 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|